C12H16F2O — CID 105129038
1-(4,4-difluorocyclohexyl)hex-4-yn-1-one (PubChem CID 105129038) has the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)hex-4-yn-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)hex-4-yn-1-one |
|---|---|
| PubChem CID | 105129038 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)hex-4-yn-1-one |
| SMILES | CC#CCCC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H16F2O/c1-2-3-4-5-11(15)10-6-8-12(13,14)9-7-10/h10H,4-9H2,1H3 |
| InChIKey | AUVQKHOIXMZEPA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|