C11H15F5O — CID 105123310
1-(4,4-difluorocyclohexyl)-5,5,5-trifluoropentan-1-one (PubChem CID 105123310) has the molecular formula C11H15F5O and a molecular weight of 258.23 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 105123310 |
| Molecular Formula | C11H15F5O |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H15F5O/c12-10(13)6-3-8(4-7-10)9(17)2-1-5-11(14,15)16/h8H,1-7H2 |
| InChIKey | QINVWRJWCGKTCY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |