C12H20F2O — CID 105091676
1-(4,4-difluorocyclohexyl)-3-methylpentan-1-one (PubChem CID 105091676) has the molecular formula C12H20F2O and a molecular weight of 218.29 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylpentan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylpentan-1-one |
|---|---|
| PubChem CID | 105091676 |
| Molecular Formula | C12H20F2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylpentan-1-one |
| SMILES | CCC(C)CC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H20F2O/c1-3-9(2)8-11(15)10-4-6-12(13,14)7-5-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | VEOUWLMJHHRCCM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |