C11H18F2O — CID 105077543
1-(4,4-difluorocyclohexyl)-3-methylbutan-1-one (PubChem CID 105077543) has the molecular formula C11H18F2O and a molecular weight of 204.26 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-methylbutan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 105077543 |
| Molecular Formula | C11H18F2O |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2O/c1-8(2)7-10(14)9-3-5-11(12,13)6-4-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | GAAIMFJKVOWKNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |