C11H18F2O3S — CID 105084255
1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-one (PubChem CID 105084255) has the molecular formula C11H18F2O3S and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 105084255 |
| Molecular Formula | C11H18F2O3S |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4-methylsulfonylbutan-1-one |
| SMILES | CS(=O)(=O)CCCC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2O3S/c1-17(15,16)8-2-3-10(14)9-4-6-11(12,13)7-5-9/h9H,2-8H2,1H3 |
| InChIKey | IWPYTNSSTRGYDH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |