About 1-cycloheptylbutan-1-one
1-cycloheptylbutan-1-one (PubChem CID 54353743) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-cycloheptylbutan-1-one.
Molecular Properties
| Compound Name | 1-cycloheptylbutan-1-one |
| PubChem CID | 54353743 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-cycloheptylbutan-1-one |
| SMILES | CCCC(=O)C1CCCCCC1 |
| InChI | InChI=1S/C11H20O/c1-2-7-11(12)10-8-5-3-4-6-9-10/h10H,2-9H2,1H3 |
| InChIKey | IRXOOVWQEWVNFS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cycloheptylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptylbutan-1-one?
The IUPAC name of 1-cycloheptylbutan-1-one (CID 54353743) is 1-cycloheptylbutan-1-one.
What is the SMILES notation for 1-cycloheptylbutan-1-one?
The canonical SMILES for 1-cycloheptylbutan-1-one is CCCC(=O)C1CCCCCC1.
What is the InChIKey of 1-cycloheptylbutan-1-one?
The InChIKey is IRXOOVWQEWVNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-2-7-11(12)10-8-5-3-4-6-9-10/h10H,2-9H2,1H3.
What are the key properties of 1-cycloheptylbutan-1-one?
1-cycloheptylbutan-1-one has a molecular weight of 168.28 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptylbutan-1-one is sourced from PubChem (CID 54353743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).