C26H40O5 — CID 147160528
1-tricyclo[3.3.1.03,7]nonanylmethoxymethyl 6-(2,3,3-trimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 147160528) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-tricyclo[3.3.1.03,7]nonanylmethoxymethyl 6-(2,3,3-trimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 1-tricyclo[3.3.1.03,7]nonanylmethoxymethyl 6-(2,3,3-trimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 147160528 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 1-tricyclo[3.3.1.03,7]nonanylmethoxymethyl 6-(2,3,3-trimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C(=O)OC1CC2CC(C(=O)OCOCC34CC5CC(C3)C(C5)C4)C1C2)C(C)(C)C |
| InChI | InChI=1S/C26H40O5/c1-15(25(2,3)4)23(27)31-22-9-16-7-20(22)21(8-16)24(28)30-14-29-13-26-10-17-5-18(11-26)19(6-17)12-26/h15-22H,5-14H2,1-4H3 |
| InChIKey | BVTDQSGWOGAHGU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|