C29H44O5 — CID 173487579
1-adamantylmethoxymethyl 6-[(2Z)-2-ethylidene-4,4-dimethylpentanoyl]oxybicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 173487579) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is 1-adamantylmethoxymethyl 6-[(2Z)-2-ethylidene-4,4-dimethylpentanoyl]oxybicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 1-adamantylmethoxymethyl 6-[(2Z)-2-ethylidene-4,4-dimethylpentanoyl]oxybicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 173487579 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | 1-adamantylmethoxymethyl 6-[(2Z)-2-ethylidene-4,4-dimethylpentanoyl]oxybicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C/C=C(/CC(C)(C)C)C(=O)OC1CC2CC(C(=O)OCOCC34CC5CC(CC(C5)C3)C4)C1C2 |
| InChI | InChI=1S/C29H44O5/c1-5-22(15-28(2,3)4)26(30)34-25-11-18-9-23(25)24(10-18)27(31)33-17-32-16-29-12-19-6-20(13-29)8-21(7-19)14-29/h5,18-21,23-25H,6-17H2,1-4H3/b22-5- |
| InChIKey | XLWUBCKFBWSHCW-IOMHPIHLSA-N |
| XLogP | 6.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|