C71H110O15 — CID 160929816
bis(1-adamantylmethoxymethyl 6-(2-methylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate);cyclohexyloxymethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 160929816) has the molecular formula C71H110O15 and a molecular weight of 1203.65 g/mol. Its IUPAC name is bis(1-adamantylmethoxymethyl 6-(2-methylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate);cyclohexyloxymethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | bis(1-adamantylmethoxymethyl 6-(2-methylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate);cyclohexyloxymethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 160929816 |
| Molecular Formula | C71H110O15 |
| Molecular Weight | 1203.65 g/mol |
| Exact Mass | 1202.78 |
| IUPAC Name | bis(1-adamantylmethoxymethyl 6-(2-methylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate);cyclohexyloxymethyl 6-(2,2-dimethylbutanoyloxy)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC(C(=O)OCOC3CCCCC3)C1C2.CCC(C)C(=O)OC1CC2CC(C(=O)OCOCC34CC5CC(CC(C5)C3)C4)C1C2.CCC(C)C(=O)OC1CC2CC(C(=O)OCOCC34CC5CC(CC(C5)C3)C4)C1C2 |
| InChI | InChI=1S/2C25H38O5.C21H34O5/c2*1-3-15(2)23(26)30-22-9-16-7-20(22)21(8-16)24(27)29-14-28-13-25-10-17-4-18(11-25)6-19(5-17)12-25;1-4-21(2,3)20(23)26-18-12-14-10-16(18)17(11-14)19(22)25-13-24-15-8-6-5-7-9-15/h2*15-22H,3-14H2,1-2H3;14-18H,4-13H2,1-3H3 |
| InChIKey | STCQXKUTHHUPAQ-UHFFFAOYSA-N |
| XLogP | 13.68 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1203.65 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|