C15H28O4 — CID 89423770
2-formyloxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 89423770) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-formyloxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 2-formyloxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 89423770 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-formyloxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCOC=O)C(C)(C)C |
| InChI | InChI=1S/C15H28O4/c1-13(2,3)10-15(7,14(4,5)6)12(17)19-9-8-18-11-16/h11H,8-10H2,1-7H3 |
| InChIKey | XLPJFEORKGIWIR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|