C25H47NO4 — CID 153363495
2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate (PubChem CID 153363495) has the molecular formula C25H47NO4 and a molecular weight of 425.65 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate.
| Compound Name | 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 153363495 |
| Molecular Formula | C25H47NO4 |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl 1,2,2,6,6-pentamethylpiperidine-4-carboxylate |
| SMILES | CN1C(C)(C)CC(C(=O)OCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C25H47NO4/c1-21(2,3)17-25(11,22(4,5)6)20(28)30-14-13-29-19(27)18-15-23(7,8)26(12)24(9,10)16-18/h18H,13-17H2,1-12H3 |
| InChIKey | OWVXLVKDCOEIQF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|