C22H44N2O — CID 135191358
2-tert-butyl-2,4,4-trimethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentanamide (PubChem CID 135191358) has the molecular formula C22H44N2O and a molecular weight of 352.61 g/mol. Its IUPAC name is 2-tert-butyl-2,4,4-trimethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentanamide.
| Compound Name | 2-tert-butyl-2,4,4-trimethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 135191358 |
| Molecular Formula | C22H44N2O |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.35 |
| IUPAC Name | 2-tert-butyl-2,4,4-trimethyl-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentanamide |
| SMILES | CN1C(C)(C)CC(NC(=O)C(C)(CC(C)(C)C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C22H44N2O/c1-18(2,3)15-22(11,19(4,5)6)17(25)23-16-13-20(7,8)24(12)21(9,10)14-16/h16H,13-15H2,1-12H3,(H,23,25) |
| InChIKey | JSGXBUBJZNOINO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |