C17H33N3O2 — CID 13446525
N-[4-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide (PubChem CID 13446525) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[4-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide.
| Compound Name | N-[4-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide |
|---|---|
| PubChem CID | 13446525 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N-[4-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide |
| SMILES | CC(=O)NCCCCN(C(C)=O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H33N3O2/c1-13(21)18-9-7-8-10-20(14(2)22)15-11-16(3,4)19-17(5,6)12-15/h15,19H,7-12H2,1-6H3,(H,18,21) |
| InChIKey | JFYNFQXLDJLVRK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|