C11H21N2O2+ — CID 2753332
N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide (PubChem CID 2753332) has the molecular formula C11H21N2O2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide.
| Compound Name | N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide |
|---|---|
| PubChem CID | 2753332 |
| Molecular Formula | C11H21N2O2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-(2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-yl)acetamide |
| SMILES | CC(=O)NC1CC(C)(C)[N+](=O)C(C)(C)C1 |
| InChI | InChI=1S/C11H20N2O2/c1-8(14)12-9-6-10(2,3)13(15)11(4,5)7-9/h9H,6-7H2,1-5H3/p+1 |
| InChIKey | RZUULVZZWUBAGM-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|