C16H31NO6S — CID 146951884
2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylamino]-2-oxoethanesulfonic acid (PubChem CID 146951884) has the molecular formula C16H31NO6S and a molecular weight of 365.49 g/mol. Its IUPAC name is 2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylamino]-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylamino]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 146951884 |
| Molecular Formula | C16H31NO6S |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethylamino]-2-oxoethanesulfonic acid |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCNC(=O)CS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO6S/c1-14(2,3)11-16(7,15(4,5)6)13(19)23-9-8-17-12(18)10-24(20,21)22/h8-11H2,1-7H3,(H,17,18)(H,20,21,22) |
| InChIKey | AIWRPDQCBDOMRQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|