C17H34O3 — CID 123574282
(1-methoxy-2-methylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123574282) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is (1-methoxy-2-methylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | (1-methoxy-2-methylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123574282 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | (1-methoxy-2-methylpropyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | COC(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H34O3/c1-12(2)13(19-10)20-14(18)17(9,16(6,7)8)11-15(3,4)5/h12-13H,11H2,1-10H3 |
| InChIKey | MXFGIVIKNVKKGF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|