C19H34O2 — CID 144597357
[(E)-3-ethenylpent-3-en-2-yl] 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 144597357) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is [(E)-3-ethenylpent-3-en-2-yl] 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | [(E)-3-ethenylpent-3-en-2-yl] 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 144597357 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | [(E)-3-ethenylpent-3-en-2-yl] 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | C=C/C(=C\C)C(C)OC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H34O2/c1-11-15(12-2)14(3)21-16(20)19(10,18(7,8)9)13-17(4,5)6/h11-12,14H,1,13H2,2-10H3/b15-12+ |
| InChIKey | MJWRJMQOHKQDTH-NTCAYCPXSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|