About (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate
(1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 118518723) has the molecular formula C20H38O2
and a molecular weight of 310.52 g/mol. Its IUPAC name is (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 118518723 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)C1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C20H38O2/c1-15(2)20(12-10-11-13-20)22-16(21)19(9,18(6,7)8)14-17(3,4)5/h15H,10-14H2,1-9H3 |
| InChIKey | NISZQANXACIGKS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate (CID 118518723) is (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate is CC(C)C1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)CCCC1.
What is the InChIKey of (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is NISZQANXACIGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O2/c1-15(2)20(12-10-11-13-20)22-16(21)19(9,18(6,7)8)14-17(3,4)5/h15H,10-14H2,1-9H3.
What are the key properties of (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
(1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 310.52 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-ylcyclopentyl) 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 118518723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).