About (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate
(1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 70989498) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
Analyze (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate (CID 70989498) is (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate is CCC1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)CCCCCCC1.
What is the InChIKey of (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is GKZAPNGZNYHBOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-9-22(15-13-11-10-12-14-16-22)24-18(23)21(8,20(5,6)7)17-19(2,3)4/h9-17H2,1-8H3.
What are the key properties of (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate?
(1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 338.58 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclooctyl) 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 70989498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).