C18H32O2 — CID 91497135
(1-ethylcyclopentyl) 2,4,4-trimethyl-2-prop-1-en-2-ylpentanoate (PubChem CID 91497135) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2,4,4-trimethyl-2-prop-1-en-2-ylpentanoate.
| Compound Name | (1-ethylcyclopentyl) 2,4,4-trimethyl-2-prop-1-en-2-ylpentanoate |
|---|---|
| PubChem CID | 91497135 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (1-ethylcyclopentyl) 2,4,4-trimethyl-2-prop-1-en-2-ylpentanoate |
| SMILES | C=C(C)C(C)(CC(C)(C)C)C(=O)OC1(CC)CCCC1 |
| InChI | InChI=1S/C18H32O2/c1-8-18(11-9-10-12-18)20-15(19)17(7,14(2)3)13-16(4,5)6/h2,8-13H2,1,3-7H3 |
| InChIKey | XSNPZOFCTZQLQT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|