C18H34N2O2 — CID 170519638
N,2,2,6,6-pentamethyl-N'-prop-2-enyl-N-propylheptanediamide (PubChem CID 170519638) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is N,2,2,6,6-pentamethyl-N'-prop-2-enyl-N-propylheptanediamide.
| Compound Name | N,2,2,6,6-pentamethyl-N'-prop-2-enyl-N-propylheptanediamide |
|---|---|
| PubChem CID | 170519638 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | N,2,2,6,6-pentamethyl-N'-prop-2-enyl-N-propylheptanediamide |
| SMILES | C=CCNC(=O)C(C)(C)CCCC(C)(C)C(=O)N(C)CCC |
| InChI | InChI=1S/C18H34N2O2/c1-8-13-19-15(21)17(3,4)11-10-12-18(5,6)16(22)20(7)14-9-2/h8H,1,9-14H2,2-7H3,(H,19,21) |
| InChIKey | VHCYGXYJHMNZMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|