C15H30N2O3 — CID 65265715
3-(3-ethylpentan-2-ylcarbamoylamino)-2,2,3-trimethylbutanoic acid (PubChem CID 65265715) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(3-ethylpentan-2-ylcarbamoylamino)-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-(3-ethylpentan-2-ylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265715 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-(3-ethylpentan-2-ylcarbamoylamino)-2,2,3-trimethylbutanoic acid |
| SMILES | CCC(CC)C(C)NC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H30N2O3/c1-8-11(9-2)10(3)16-13(20)17-15(6,7)14(4,5)12(18)19/h10-11H,8-9H2,1-7H3,(H,18,19)(H2,16,17,20) |
| InChIKey | XBZKGLQPUVFGMI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |