C11H22BrNO — CID 114328721
2-bromo-N-(3-ethylpentan-2-yl)-2-methylpropanamide (PubChem CID 114328721) has the molecular formula C11H22BrNO and a molecular weight of 264.21 g/mol. Its IUPAC name is 2-bromo-N-(3-ethylpentan-2-yl)-2-methylpropanamide.
| Compound Name | 2-bromo-N-(3-ethylpentan-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 114328721 |
| Molecular Formula | C11H22BrNO |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-bromo-N-(3-ethylpentan-2-yl)-2-methylpropanamide |
| SMILES | CCC(CC)C(C)NC(=O)C(C)(C)Br |
| InChI | InChI=1S/C11H22BrNO/c1-6-9(7-2)8(3)13-10(14)11(4,5)12/h8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | ZCINJKNWYGWGGJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|