C11H23BrN2O — CID 114328559
2-bromo-N-[1-(diethylamino)propan-2-yl]-2-methylpropanamide (PubChem CID 114328559) has the molecular formula C11H23BrN2O and a molecular weight of 279.22 g/mol. Its IUPAC name is 2-bromo-N-[1-(diethylamino)propan-2-yl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[1-(diethylamino)propan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 114328559 |
| Molecular Formula | C11H23BrN2O |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-bromo-N-[1-(diethylamino)propan-2-yl]-2-methylpropanamide |
| SMILES | CCN(CC)CC(C)NC(=O)C(C)(C)Br |
| InChI | InChI=1S/C11H23BrN2O/c1-6-14(7-2)8-9(3)13-10(15)11(4,5)12/h9H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | KUGFPXFOAVQHJJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|