C9H18BrNO2 — CID 114329161
2-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-methylpropanamide (PubChem CID 114329161) has the molecular formula C9H18BrNO2 and a molecular weight of 252.15 g/mol. Its IUPAC name is 2-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-methylpropanamide.
| Compound Name | 2-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 114329161 |
| Molecular Formula | C9H18BrNO2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-bromo-N-(4-hydroxy-3-methylbutan-2-yl)-2-methylpropanamide |
| SMILES | CC(CO)C(C)NC(=O)C(C)(C)Br |
| InChI | InChI=1S/C9H18BrNO2/c1-6(5-12)7(2)11-8(13)9(3,4)10/h6-7,12H,5H2,1-4H3,(H,11,13) |
| InChIKey | VVHBZGICCHGOPU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|