C14H24N4O2 — CID 75373143
1-(2-tert-butylpyrimidin-5-yl)-3-(4-hydroxy-3-methylbutan-2-yl)urea (PubChem CID 75373143) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-tert-butylpyrimidin-5-yl)-3-(4-hydroxy-3-methylbutan-2-yl)urea.
| Compound Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 75373143 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
| SMILES | CC(CO)C(C)NC(=O)Nc1cnc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C14H24N4O2/c1-9(8-19)10(2)17-13(20)18-11-6-15-12(16-7-11)14(3,4)5/h6-7,9-10,19H,8H2,1-5H3,(H2,17,18,20) |
| InChIKey | CRKQGDACBSBLMF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |