C16H27N5O2 — CID 95300949
N-[(2R)-butan-2-yl]-3-[(2-tert-butylpyrimidin-5-yl)carbamoylamino]propanamide (PubChem CID 95300949) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3-[(2-tert-butylpyrimidin-5-yl)carbamoylamino]propanamide.
| Compound Name | N-[(2R)-butan-2-yl]-3-[(2-tert-butylpyrimidin-5-yl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 95300949 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3-[(2-tert-butylpyrimidin-5-yl)carbamoylamino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)CCNC(=O)Nc1cnc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C16H27N5O2/c1-6-11(2)20-13(22)7-8-17-15(23)21-12-9-18-14(19-10-12)16(3,4)5/h9-11H,6-8H2,1-5H3,(H,20,22)(H2,17,21,23)/t11-/m1/s1 |
| InChIKey | LMDXNNFBJOEJLY-LLVKDONJSA-N |
| XLogP | 2.20 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |