C15H26N4O2 — CID 111424877
1-(2-tert-butylpyrimidin-5-yl)-3-(1-hydroxy-4-methylpentan-2-yl)urea (PubChem CID 111424877) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-(2-tert-butylpyrimidin-5-yl)-3-(1-hydroxy-4-methylpentan-2-yl)urea.
| Compound Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(1-hydroxy-4-methylpentan-2-yl)urea |
|---|---|
| PubChem CID | 111424877 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(1-hydroxy-4-methylpentan-2-yl)urea |
| SMILES | CC(C)CC(CO)NC(=O)Nc1cnc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C15H26N4O2/c1-10(2)6-11(9-20)18-14(21)19-12-7-16-13(17-8-12)15(3,4)5/h7-8,10-11,20H,6,9H2,1-5H3,(H2,18,19,21) |
| InChIKey | GRMNTYPSJIBUKR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |