C15H23N5O3 — CID 127751996
1-(2-tert-butylpyrimidin-5-yl)-3-(2-morpholin-4-yl-2-oxoethyl)urea (PubChem CID 127751996) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-(2-tert-butylpyrimidin-5-yl)-3-(2-morpholin-4-yl-2-oxoethyl)urea.
| Compound Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(2-morpholin-4-yl-2-oxoethyl)urea |
|---|---|
| PubChem CID | 127751996 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-(2-tert-butylpyrimidin-5-yl)-3-(2-morpholin-4-yl-2-oxoethyl)urea |
| SMILES | CC(C)(C)c1ncc(NC(=O)NCC(=O)N2CCOCC2)cn1 |
| InChI | InChI=1S/C15H23N5O3/c1-15(2,3)13-16-8-11(9-17-13)19-14(22)18-10-12(21)20-4-6-23-7-5-20/h8-9H,4-7,10H2,1-3H3,(H2,18,19,22) |
| InChIKey | ANHUOAOAJQWPBD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |