C17H26N6O — CID 71926143
1-(2-tert-butylpyrimidin-5-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea (PubChem CID 71926143) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(2-tert-butylpyrimidin-5-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea.
| Compound Name | 1-(2-tert-butylpyrimidin-5-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 71926143 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-(2-tert-butylpyrimidin-5-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea |
| SMILES | CC(C)Cn1ccnc1CNC(=O)Nc1cnc(C(C)(C)C)nc1 |
| InChI | InChI=1S/C17H26N6O/c1-12(2)11-23-7-6-18-14(23)10-21-16(24)22-13-8-19-15(20-9-13)17(3,4)5/h6-9,12H,10-11H2,1-5H3,(H2,21,22,24) |
| InChIKey | BKRTYMKFDSOQJU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |