C18H32N4O2 — CID 84586574
1-(2-cyclohexyl-1-hydroxypropan-2-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea (PubChem CID 84586574) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(2-cyclohexyl-1-hydroxypropan-2-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea.
| Compound Name | 1-(2-cyclohexyl-1-hydroxypropan-2-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 84586574 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-(2-cyclohexyl-1-hydroxypropan-2-yl)-3-[[1-(2-methylpropyl)imidazol-2-yl]methyl]urea |
| SMILES | CC(C)Cn1ccnc1CNC(=O)NC(C)(CO)C1CCCCC1 |
| InChI | InChI=1S/C18H32N4O2/c1-14(2)12-22-10-9-19-16(22)11-20-17(24)21-18(3,13-23)15-7-5-4-6-8-15/h9-10,14-15,23H,4-8,11-13H2,1-3H3,(H2,20,21,24) |
| InChIKey | USKKGPQAXTXTTI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |