C7H12KNO4S — CID 87553000
potassium 1-(2-methylprop-2-enoylamino)propane-1-sulfonate (PubChem CID 87553000) has the molecular formula C7H12KNO4S and a molecular weight of 245.34 g/mol. Its IUPAC name is potassium 1-(2-methylprop-2-enoylamino)propane-1-sulfonate.
| Compound Name | potassium 1-(2-methylprop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 87553000 |
| Molecular Formula | C7H12KNO4S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | potassium 1-(2-methylprop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=C(C)C(=O)NC(CC)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C7H13NO4S.K/c1-4-6(13(10,11)12)8-7(9)5(2)3;/h6H,2,4H2,1,3H3,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | KYCJOCVSNDFLNH-UHFFFAOYSA-M |
| XLogP | -3.04 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|