C13H26N2O — CID 139776232
N-[1-(diethylamino)-2,2-dimethylpropyl]-2-methylprop-2-enamide (PubChem CID 139776232) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-[1-(diethylamino)-2,2-dimethylpropyl]-2-methylprop-2-enamide.
| Compound Name | N-[1-(diethylamino)-2,2-dimethylpropyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 139776232 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-[1-(diethylamino)-2,2-dimethylpropyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(N(CC)CC)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O/c1-8-15(9-2)12(13(5,6)7)14-11(16)10(3)4/h12H,3,8-9H2,1-2,4-7H3,(H,14,16) |
| InChIKey | BQDSREZYVIKQMN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|