C11H21Cl3N2O — CID 2252471
2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(diethylamino)ethyl]propanamide (PubChem CID 2252471) has the molecular formula C11H21Cl3N2O and a molecular weight of 303.66 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(diethylamino)ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 2252471 |
| Molecular Formula | C11H21Cl3N2O |
| Molecular Weight | 303.66 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2,2-dimethyl-N-[(1R)-2,2,2-trichloro-1-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)[C@@H](NC(=O)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H21Cl3N2O/c1-6-16(7-2)8(11(12,13)14)15-9(17)10(3,4)5/h8H,6-7H2,1-5H3,(H,15,17)/t8-/m1/s1 |
| InChIKey | HVVJUXFOQXODOL-MRVPVSSYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|