C11H21NOS — CID 89088589
N-(1-tert-butylsulfanylpropan-2-yl)-2-methylprop-2-enamide (PubChem CID 89088589) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is N-(1-tert-butylsulfanylpropan-2-yl)-2-methylprop-2-enamide.
| Compound Name | N-(1-tert-butylsulfanylpropan-2-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 89088589 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(1-tert-butylsulfanylpropan-2-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(C)CSC(C)(C)C |
| InChI | InChI=1S/C11H21NOS/c1-8(2)10(13)12-9(3)7-14-11(4,5)6/h9H,1,7H2,2-6H3,(H,12,13) |
| InChIKey | KVRIZVJYGSLIHU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|