C15H26O5S — CID 155346560
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-tert-butylsulfanyl-2-methylpropanoate (PubChem CID 155346560) has the molecular formula C15H26O5S and a molecular weight of 318.44 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-tert-butylsulfanyl-2-methylpropanoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-tert-butylsulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 155346560 |
| Molecular Formula | C15H26O5S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 3-tert-butylsulfanyl-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(C)CSC(C)(C)C |
| InChI | InChI=1S/C15H26O5S/c1-10(2)13(17)19-7-12(16)8-20-14(18)11(3)9-21-15(4,5)6/h11-12,16H,1,7-9H2,2-6H3 |
| InChIKey | QZXRRHBLSZIMNE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|