C14H21O7RfS- — CID 59108108
methanidyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2-methylpropanoate;rutherfordium (PubChem CID 59108108) has the molecular formula C14H21O7RfS- and a molecular weight of 600.38 g/mol. Its IUPAC name is methanidyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2-methylpropanoate;rutherfordium.
| Compound Name | methanidyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2-methylpropanoate;rutherfordium |
|---|---|
| PubChem CID | 59108108 |
| Molecular Formula | C14H21O7RfS- |
| Molecular Weight | 600.38 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | methanidyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2-methylpropanoate;rutherfordium |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)O[CH2-].[Rf] |
| InChI | InChI=1S/C14H21O7S.Rf/c1-9(2)13(17)21-6-11(15)5-20-12(16)8-22-7-10(3)14(18)19-4;/h10-11,15H,1,4-8H2,2-3H3;/q-1; |
| InChIKey | JKCKXUWTTURQKY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.38 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|