C17H32O7S — CID 159199555
methane;methyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2,2-dimethylpropanoate (PubChem CID 159199555) has the molecular formula C17H32O7S and a molecular weight of 380.50 g/mol. Its IUPAC name is methane;methyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2,2-dimethylpropanoate.
| Compound Name | methane;methyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159199555 |
| Molecular Formula | C17H32O7S |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | methane;methyl 3-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-2-oxoethyl]sulfanyl-2,2-dimethylpropanoate |
| SMILES | C.C.C=C(C)C(=O)OCC(O)COC(=O)CSCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H24O7S.2CH4/c1-10(2)13(18)22-7-11(16)6-21-12(17)8-23-9-15(3,4)14(19)20-5;;/h11,16H,1,6-9H2,2-5H3;2*1H4 |
| InChIKey | KPCOBHMEMYCNQM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|