C14H22O6S — CID 59117330
methyl 2,2-dimethyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanylpropanoate (PubChem CID 59117330) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 2,2-dimethyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 59117330 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | methyl 2,2-dimethyl-3-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethyl]sulfanylpropanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CSCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C14H22O6S/c1-10(2)12(16)20-7-6-19-11(15)8-21-9-14(3,4)13(17)18-5/h1,6-9H2,2-5H3 |
| InChIKey | GDEBGCJKEFCHPI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|