C13H20O6S — CID 90322710
1-hydroxyethenyl 3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanyl-2-methylpropanoate (PubChem CID 90322710) has the molecular formula C13H20O6S and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-hydroxyethenyl 3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanyl-2-methylpropanoate.
| Compound Name | 1-hydroxyethenyl 3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 90322710 |
| Molecular Formula | C13H20O6S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-hydroxyethenyl 3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]sulfanyl-2-methylpropanoate |
| SMILES | C=C(O)OC(=O)C(C)CSCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C13H20O6S/c1-8(2)12(16)18-5-11(15)7-20-6-9(3)13(17)19-10(4)14/h9,11,14-15H,1,4-7H2,2-3H3 |
| InChIKey | IHOIZQVJEMMTQA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|