C7H12ClNO — CID 23228242
N-(1-chloropropyl)-2-methylprop-2-enamide (PubChem CID 23228242) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is N-(1-chloropropyl)-2-methylprop-2-enamide.
| Compound Name | N-(1-chloropropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23228242 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | N-(1-chloropropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(Cl)CC |
| InChI | InChI=1S/C7H12ClNO/c1-4-6(8)9-7(10)5(2)3/h6H,2,4H2,1,3H3,(H,9,10) |
| InChIKey | DNXJRGVZQNLIHW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|