C16H39NO4Si4 — CID 18769275
2-methyl-N-[1-tris(trimethylsilyloxy)silylpropyl]prop-2-enamide (PubChem CID 18769275) has the molecular formula C16H39NO4Si4 and a molecular weight of 421.84 g/mol. Its IUPAC name is 2-methyl-N-[1-tris(trimethylsilyloxy)silylpropyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[1-tris(trimethylsilyloxy)silylpropyl]prop-2-enamide |
|---|---|
| PubChem CID | 18769275 |
| Molecular Formula | C16H39NO4Si4 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-methyl-N-[1-tris(trimethylsilyloxy)silylpropyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H39NO4Si4/c1-13-15(17-16(18)14(2)3)25(19-22(4,5)6,20-23(7,8)9)21-24(10,11)12/h15H,2,13H2,1,3-12H3,(H,17,18) |
| InChIKey | UKNCSISTHAJBNN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|