About 1-methoxyethyl N-but-1-en-2-ylcarbamate
1-methoxyethyl N-but-1-en-2-ylcarbamate (PubChem CID 130331171) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-methoxyethyl N-but-1-en-2-ylcarbamate.
Molecular Properties
| Compound Name | 1-methoxyethyl N-but-1-en-2-ylcarbamate |
| PubChem CID | 130331171 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 1-methoxyethyl N-but-1-en-2-ylcarbamate |
| SMILES | C=C(CC)NC(=O)OC(C)OC |
| InChI | InChI=1S/C8H15NO3/c1-5-6(2)9-8(10)12-7(3)11-4/h7H,2,5H2,1,3-4H3,(H,9,10) |
| InChIKey | WUDUDSHIJNQUKH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl N-but-1-en-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl N-but-1-en-2-ylcarbamate?
The IUPAC name of 1-methoxyethyl N-but-1-en-2-ylcarbamate (CID 130331171) is 1-methoxyethyl N-but-1-en-2-ylcarbamate.
What is the SMILES notation for 1-methoxyethyl N-but-1-en-2-ylcarbamate?
The canonical SMILES for 1-methoxyethyl N-but-1-en-2-ylcarbamate is C=C(CC)NC(=O)OC(C)OC.
What is the InChIKey of 1-methoxyethyl N-but-1-en-2-ylcarbamate?
The InChIKey is WUDUDSHIJNQUKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-5-6(2)9-8(10)12-7(3)11-4/h7H,2,5H2,1,3-4H3,(H,9,10).
What are the key properties of 1-methoxyethyl N-but-1-en-2-ylcarbamate?
1-methoxyethyl N-but-1-en-2-ylcarbamate has a molecular weight of 173.21 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl N-but-1-en-2-ylcarbamate is sourced from PubChem (CID 130331171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).