C6H12N2 — CID 166131853
1-N'-but-1-en-2-ylethene-1,1-diamine (PubChem CID 166131853) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-N'-but-1-en-2-ylethene-1,1-diamine.
| Compound Name | 1-N'-but-1-en-2-ylethene-1,1-diamine |
|---|---|
| PubChem CID | 166131853 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-N'-but-1-en-2-ylethene-1,1-diamine |
| SMILES | C=C(N)NC(=C)CC |
| InChI | InChI=1S/C6H12N2/c1-4-5(2)8-6(3)7/h8H,2-4,7H2,1H3 |
| InChIKey | SEOMTMDYZOZJMN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |