C5H11N3 — CID 146561035
(Z)-2-N-(1-aminoethenyl)prop-1-ene-1,2-diamine (PubChem CID 146561035) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is (Z)-2-N-(1-aminoethenyl)prop-1-ene-1,2-diamine.
| Compound Name | (Z)-2-N-(1-aminoethenyl)prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 146561035 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (Z)-2-N-(1-aminoethenyl)prop-1-ene-1,2-diamine |
| SMILES | C=C(N)N/C(C)=C\N |
| InChI | InChI=1S/C5H11N3/c1-4(3-6)8-5(2)7/h3,8H,2,6-7H2,1H3/b4-3- |
| InChIKey | YNLBPSWVBXTSMG-ARJAWSKDSA-N |
| XLogP | -0.17 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |