About ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine
ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine (PubChem CID 168977027) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine.
Molecular Properties
| Compound Name | ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine |
| PubChem CID | 168977027 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine |
| SMILES | C=C(N)OC.CC.CC(C)=CN |
| InChI | InChI=1S/C4H9N.C3H7NO.C2H6/c1-4(2)3-5;1-3(4)5-2;1-2/h3H,5H2,1-2H3;1,4H2,2H3;1-2H3 |
| InChIKey | WCCPPLNLCVSOAQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine?
The IUPAC name of ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine (CID 168977027) is ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine.
What is the SMILES notation for ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine?
The canonical SMILES for ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine is C=C(N)OC.CC.CC(C)=CN.
What is the InChIKey of ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine?
The InChIKey is WCCPPLNLCVSOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C3H7NO.C2H6/c1-4(2)3-5;1-3(4)5-2;1-2/h3H,5H2,1-2H3;1,4H2,2H3;1-2H3.
What are the key properties of ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine?
ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine has a molecular weight of 174.29 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxyethenamine;2-methylprop-1-en-1-amine is sourced from PubChem (CID 168977027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).