About fluoromethane;2-methoxyprop-1-ene
fluoromethane;2-methoxyprop-1-ene (PubChem CID 143721713) has the molecular formula C6H14F2O
and a molecular weight of 140.17 g/mol. Its IUPAC name is fluoromethane;2-methoxyprop-1-ene.
Molecular Properties
| Compound Name | fluoromethane;2-methoxyprop-1-ene |
| PubChem CID | 143721713 |
| Molecular Formula | C6H14F2O |
| Molecular Weight | 140.17 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | fluoromethane;2-methoxyprop-1-ene |
| SMILES | C=C(C)OC.CF.CF |
| InChI | InChI=1S/C4H8O.2CH3F/c1-4(2)5-3;2*1-2/h1H2,2-3H3;2*1H3 |
| InChIKey | XNOGVPUXFPUUPI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;2-methoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;2-methoxyprop-1-ene?
The IUPAC name of fluoromethane;2-methoxyprop-1-ene (CID 143721713) is fluoromethane;2-methoxyprop-1-ene.
What is the SMILES notation for fluoromethane;2-methoxyprop-1-ene?
The canonical SMILES for fluoromethane;2-methoxyprop-1-ene is C=C(C)OC.CF.CF.
What is the InChIKey of fluoromethane;2-methoxyprop-1-ene?
The InChIKey is XNOGVPUXFPUUPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.2CH3F/c1-4(2)5-3;2*1-2/h1H2,2-3H3;2*1H3.
What are the key properties of fluoromethane;2-methoxyprop-1-ene?
fluoromethane;2-methoxyprop-1-ene has a molecular weight of 140.17 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;2-methoxyprop-1-ene is sourced from PubChem (CID 143721713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).