About fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate
fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate (PubChem CID 163278180) has the molecular formula C9H16FNO
and a molecular weight of 173.23 g/mol. Its IUPAC name is fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate.
Molecular Properties
| Compound Name | fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate |
| PubChem CID | 163278180 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate |
| SMILES | C=C(C)/C(=N/C=C\C)OC.CF |
| InChI | InChI=1S/C8H13NO.CH3F/c1-5-6-9-8(10-4)7(2)3;1-2/h5-6H,2H2,1,3-4H3;1H3/b6-5-,9-8-; |
| InChIKey | CIAPOKXMXNZXHW-YYYWGHDMSA-N |
| XLogP | 2.73 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate?
The IUPAC name of fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate (CID 163278180) is fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate.
What is the SMILES notation for fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate?
The canonical SMILES for fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate is C=C(C)/C(=N/C=C\C)OC.CF.
What is the InChIKey of fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate?
The InChIKey is CIAPOKXMXNZXHW-YYYWGHDMSA-N. The full InChI is InChI=1S/C8H13NO.CH3F/c1-5-6-9-8(10-4)7(2)3;1-2/h5-6H,2H2,1,3-4H3;1H3/b6-5-,9-8-;.
What are the key properties of fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate?
fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate has a molecular weight of 173.23 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;methyl 2-methyl-N-[(Z)-prop-1-enyl]prop-2-enimidate is sourced from PubChem (CID 163278180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).