C9H12N2 — CID 155705669
N,2-dimethylidene-N'-[(Z)-prop-1-enyl]but-3-enimidamide (PubChem CID 155705669) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is N,2-dimethylidene-N'-[(Z)-prop-1-enyl]but-3-enimidamide.
| Compound Name | N,2-dimethylidene-N'-[(Z)-prop-1-enyl]but-3-enimidamide |
|---|---|
| PubChem CID | 155705669 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N,2-dimethylidene-N'-[(Z)-prop-1-enyl]but-3-enimidamide |
| SMILES | C=CC(=C)C(N=C)=N/C=C\C |
| InChI | InChI=1S/C9H12N2/c1-5-7-11-9(10-4)8(3)6-2/h5-7H,2-4H2,1H3/b7-5-,11-9- |
| InChIKey | LRRMTBRWBCQEJH-CXHWBCNXSA-N |
| XLogP | 2.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|