C12H16N2 — CID 146342540
3-N,4-N-bis[(Z)-prop-1-enyl]hexa-1,5-diene-3,4-diimine (PubChem CID 146342540) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-N,4-N-bis[(Z)-prop-1-enyl]hexa-1,5-diene-3,4-diimine.
| Compound Name | 3-N,4-N-bis[(Z)-prop-1-enyl]hexa-1,5-diene-3,4-diimine |
|---|---|
| PubChem CID | 146342540 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-N,4-N-bis[(Z)-prop-1-enyl]hexa-1,5-diene-3,4-diimine |
| SMILES | C=CC(=N/C=C\C)/C(C=C)=N/C=C\C |
| InChI | InChI=1S/C12H16N2/c1-5-9-13-11(7-3)12(8-4)14-10-6-2/h5-10H,3-4H2,1-2H3/b9-5-,10-6-,13-11+,14-12+ |
| InChIKey | YLRKOGVWYRZDQX-QMPLAOCDSA-N |
| XLogP | 3.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|